All categories

3 years ago

Explain the connection between energy quanta and energy levels.

1 answer:

7 0

A quantum (plural, quanta) is the minimum amount of energy that can be absorbed or released by matter. It is a discrete, or distinct, amount of energy. ... Thus, they can occupy only fixed energy levels around the nucleus that correspond to quantum increases in energy.

You might be interested in

What is the volume of 2 mol of chlorine gas at STP? 2.0 L 11.2 L 22.4 L 44.8 L

nirvana33 [79]

Answer:

44.8 L

Explanation:

Using the ideal gas law equation:

PV = nRT

Where;

P = pressure (atm)

V = volume (L)

n = number of moles (mol)

R = gas law constant (0.0821 Latm/molK)

T = temperature (K)

At Standard temperature and pressure (STP);

P = 1 atm

T = 273K

Hence, when n = 2moles, the volume of the gas is:

Using PV = nRT

1 × V = 2 × 0.0821 × 273

V = 44.83

V = 44.8 L

7 0

2 years ago

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

3 years ago

Which of the following is the best example of kinetic energy being transformed into potential energy?

galben [10]

Answer:

The correct answer is A

Explanation:

That water stops moving once it gets to the dam and turns into potential energy

5 0

3 years ago

When you convert a measurement from SI to English, what changes? units , values , error , or resolution

Julli [10]

The answer to your question is units and values

6 0

3 years ago

You wash dishes for a chemistry laboratory to make extra money for laundry. You earn 12 dollars/hour, and each shift lasts 75 mi

nadezda [96]

Answer:

A)You must work 2 shifts to wash 10 loads of laundry

B)You can wash 15 loads pf laundry if you work for 3 shifts

C) each shift will pay for 3.75 loads of laundry if the cost per load rises to 16 quarters

Explanation:

Given:

amount earned = 12 dollars/hour

Duration for one shift = 75 minutes

Amount needed for Laundry = 12 quarters/load.

A. How many shifts must you work if you wish to wash 10 loads of laundry

To wash 10 loads, you will be requiring

=> $10 \times 12 \text{quarters}$

=> 120 quarters

1 quarter = 0.25 dollars---------------------------------(1)

120 quarters

= $120 \times 0.25 \text{ dollars}$

= 30 dollars

You need 30 dollars for washing 10 loads

In one hour i,e 60 minutes you earn= 12 dollars

In one minute the amount earned will be

$= \frac {12}{60}$

= 0.2 dollar-------------------------------------------------------(2)

Now to earn 30 dollars you have to work for

= $30 \times 0.2$ minutes

= 150 minutes

Thus the number of shifts will be

= $\frac{150}{75}$

= 2 shifts

B. How many loads of laundry can you wash if you work 3 shifts

We Know that 1 shift = 75 minutes

So 3 shifts = $75 \times 3$ = 225 minutes

From (2),

In 1 minute = 0.2 dollars is earned

So in 225 minutes = 225 \ times 0.2 = 45 dollar is earned

45 dollar = $45 \times 4$ = 180 quarters

You can wash 1 load with 12 quarters

With 180 quarters you can wash = $\frac{180}{12}$ = 15 loads

C. How many loads of laundry will each shift pay for if the cost per load rises to 16 quarters

Cost per load = 16 quarters

From (1)

16 quarters = $0.25 \times 16$ = 4 dollars per load

From (2) In 1 shift the amount earned will be

=> $75 \times 0.2$

=15 dollars

With 4 dollars you can wash 1 load

So with 15 dollars = $\frac{15}{4}$ = 3.75 loads

4 0

3 years ago