Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:There are three main properties of chemical bonds that must be considered—namely, their strength, length, and polarity. The polarity of a bond is the distribution of electrical charge over the atoms joined by the bond. Specifically, it is found that, while bonds between identical atoms (as in H2) are electrically uniform in the sense that both hydrogen atoms are electrically neutral, bonds between atoms of different elements are electrically inequivalent. In hydrogen chloride, for example, the hydrogen atom is slightly positively charged whereas the chlorine atom is slightly negatively charged. The slight electrical charges on dissimilar atoms are called partial charges, and the presence of partial charges signifies the occurrence of a polar bond.
Explanation:
Answer:
Explanation:
Part two of Dalton's theory had to be modified after mass spectrometry experiments demonstrated that atoms of the same element can have different masses because the number of neutrons can vary for different isotopes of the same element. ... Scientists have even developed the technology to see the world on an atomic level!
hoped i helped you :)
<span><u><em>Answer:</em></u>
All of the above
<u><em>Explanation:</em></u>
Vertebrates are a class of creatures falling under kingdom "<u>Animalia</u>" that are characterized by the presence of an internal skeleton composed of bones.
<u>Vertebrates are characterized by the following:</u>
1- presence of internal skeleton
2- developed brain
3- the presence of an advanced nervous system connected to the brain
4- presence of muscles that allow movement
5- protective skin
6- circulation of blood in the bodies in the vessels
Comparing the mentioned characteristics with the options given, we will find that the most suitable answer is: <u>"all of the above"</u>.
Hope this helps :)</span>
Answer:
i hope this helped
They have no true nucleus as the DNA is not contained within a membrane or separated from the rest of the cell, but is coiled up in a region of the cytoplasm called the nucleoid. Prokaryotic organisms have varying cell shapes.
Explanation:
