3 years ago

Most metals are in the liquid state at room temperature.

1 answer:

7 0

That statement is False.

Most metals are in the solid state at room temperature. The only metal that is in liquid state in the room temperature is Mercury, (Hg)

You might be interested in

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

3 years ago

Oxidation is _______?

Vika [28.1K]

Answer:

the process or result of oxidizing or being oxidized

6 0

3 years ago

If a little old lady is doing 98.3 kilometers/hour, will she get a speeding ticket if the speed limit is 55 miles / hour? [USE:

shutvik [7]

Answer:

It is possible she could get one.

Explanation:

To solve this problem we need to convert 98.3 kilometers/hour to miles/hour.

In other words, we convert km to mi, to do so we multiply 98.3 km by a conversion factor, putting the unit we want to have in the numerator, and the unit we want to convert in the denominator:

98.3 km * $\frac{1000m}{1km} *\frac{100cm}{1m}*\frac{1in}{2.54cm} *\frac{1ft}{12in} *\frac{1mi}{5280ft}$ = 61 mi

Given that the little old lady is doing 61 miles/hour, she could get a speeding ticket.

7 0

3 years ago

Why is ZnCI2 a compound

liraira [26]

There are 2 different types of atoms there, that's why

3 0

3 years ago

If you could count two atoms every second, how long would it take you to count a mole of atoms? Assume that you counted continua

jarptica [38.1K]

Answer:

It would take 9.54 x 10^15 years to count 1 mole of atoms which is 10^6 times the age of Earth.

Explanation:

6 0

3 years ago