Answer:
8.45 moles are produced
Explanation:
CaCl₂ + Na₂CO₃ → CaCO₃ + 2 NaCl
From the equation, we can see that for every 1 mole of CaCl₂ and 1 mole Na₂CO₃ will give 1 mole of CaCO₃ and 2 moles of NaCl
to calculate how many moles of CaCO₃ ,we simply multiply multiply each by the 8.45 moles of CaCl₂ which will reacts
these is because for every 1 mole of CaCl₂ and 1 mole Na₂CO₃ will give 1 mole of CaCO₃ and 2 moles of NaCl
therefore we have every 1x8.45(8.45) mole of CaCl₂ and 1x8.45(8.45) mole Na₂CO₃ will give 1x8.45(8.45) mole of CaCO₃ and 2x8.45(16.9) moles of NaCl
8.45 moles are produced in the reaction
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Approximately 119.4 g, you take the mass on the periodic table of each element and add the numbers up
Answer:
1.33 atm
Explanation:
use general gas equation P1 V1/ T1 = P2 V2/ T2
rearrange and make P2 the subject then solve,it should give you 1.33 atm
Answer:
coral bleaching is when the temperature of the water changes (even slight changes in temperature effect coral) and the coral reacts negatively to it causing it to die. unfortunately corals cannot recover once they have been bleached.
