Which statement is TRUE concerning the particle arrangement of a solid? A) the particles have no definite shape B) the particles
have an undefined volume C) the particles are closely packed together D) particles can only exist at extremely high temperatures
2 answers:
C is the correct answer.
If you find my answer helpful, please brainliest me!
You might be interested in
Answer:
The answer is 500
Explanation:
It produces only virtual images is the answer
<span>Chemical and kinetic energy...</span>
C = 5/9 (F-32)Part 1. C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit
