Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
Properties of transition elements
they are all metals and that most of them are hard, strong, and lustrous, have high melting and boiling points, and are good conductors of heat and electricity.
Fireworks
An exothermic reaction is one where the products have lower energy than the reactants, so the reaction yields energy. The chemical compounds present in firework fuel release a lot of energy upon oxidation. Photosynthesis is endothermic, settling of silt is not a chemical reaction, it is a physical change. Finally, the bubble formation in soda is not exothermic; otherwise, the sodas would become very hot very fast.
A nuclear reaction in which a heavy nuclear splits spontaneously or on impact with another particle with the release of energy- fission
A nuclear reaction in which atomic nucleus with the release of energy-fusion
The energy harnessed in nuclei is released in nuclear reaction. Fission is the splitting of a heavy nucleus into lighter nuclei and fusion is the combining of nuclei to form a bigger and heavier nucleus