Penurunan atau kehilangan massa otot bisa menimbulkan penurunan berat badan yang tidak direncanakan
Answer is: both reactions
are exothermic.
<span>
In exothermic reactions, heat is released and enthalpy of reaction is less than
zero (as it show second chemical reaction).
According to Le Chatelier's principle when the reaction
is exothermic heat is included as a product (as it show first
chemical reaction).</span>
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
The Answer is D. Suspending a heavy weight with a strong chain.
