Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
the big number describes the number ratio in a chemical equation
so for example,
2H2 + O2 --> 2H2O means
2 moles of hydrogen reacts with one mole of oxygen to form 2 moles of water
and as you know, the small (subscript) number determines the number of atoms of that element in one molecule of a compound
so I believe that drawing a normal lewis structure ( O=O ) should be correct
Answer :- In a light wave the property of wave which tells about the color of light is it's Wavelength .
Wavelength is the distance between one crest and one through , also it is the distance after which the wave repeat itself !
It's SI unit is meter !
It is scalar quantity !!
Different Wavelength of light have different color !!
• VIBGYOR
i.e, Violent , Indigo , Blue , Green , Yellow Orange, and Red along with their shades are the colors which we can see !!
• They almost range from 400nm to 700nm ( visible range of light )
Answer:
frequency of light (f) = 1 x 10¹⁵s⁻¹
Explanation:
Given Data:
Wavelength of light λ = 3.0 x10⁻⁷m
Frequency of light: to be calculated
Formula Used to find frequency:
f = V/λ ........................... (1)
where
f is the frequency
V is the velocity
λ is wavelength
Velocity of light = 3 x 10⁸ ms⁻¹
put the values in equation (1)
f = 3 x 10⁸ ms⁻¹ / 3.0 x10⁻⁷m
f = 1 x 10¹⁵s⁻¹
So the frequency of light = 1 x 10¹⁵s⁻¹
