I think the effect of increasing temperature would be; the equilbrium will shift back wards. Increase in temperature favors backward reaction since the forward reaction is exothermic and the backward reaction is endothermic. Therefore, the equilibrium will shift back wards, and there will be more reactants (H2 and Cl2) compared to the products
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
First you find out how much each element has
Fe=1 * 2 Fe=1
Cl=2 *3 Cl=3 *2
now we multiply each so we can balance each side.
So now we get our balanced equation
2 Fe + 3 Cl2 = 2 FeCl<span>3</span>
Answer: 7.025959200000001
Explanation:
