Which of these salts is insoluble in water?

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

2 years ago

In a titration of 47.41 mL of 0.3764 M ammonia with 0.3838 M aqueous nitric acid, what is the pH of the solution when 47.41 mL +

Volgvan

Answer: The pH of the solution is 1.136

Explanation:

To calculate the moles from molarity, we use the equation:

$\text{Molarity of the solution}=\frac{\text{Moles of solute}}{\text{Volume of solution (in L)}}$

For ammonia:

Molarity of ammonia = 0.3764 M

Volume of ammonia = 47.41 mL = 0.04741 L (Conversion factor: 1 L = 1000 mL)

Putting values in above equation, we get:

$0.3764mol/L=\frac{\text{Moles of ammonia}}{0.04741L}\\\\\text{Moles of ammonia}=0.01784mol$

For nitric acid:

Molarity of nitric acid = 0.3838 M

Volume of ammonia = (47.41 + 10.00) mL = 57.41 mL= 0.05741 L

Putting values in above equation, we get:

$0.3838mol/L=\frac{\text{Moles of nitric acid}}{0.05741L}\\\\\text{Moles of nitric acid}=0.02203mol$

After the completion of reaction, amount of nitric acid remained = 0.022 - 0.0178 = 0.0042 mol

For the reaction of ammonia with nitric acid, the equation follows:

$NH_3+HNO_3\rightarrow NH_4NO_3$

At $t=0$ 0.0178 0.022

Completion 0 0.0042 0.0178

As, the solution of the reaction is made from strong acid which is nitric acid and the conjugate acid of weak base which is ammonia. So, the pH of the reaction will be based totally on the concentration of nitric acid.

To calculate the pH of the reaction, we use the equation:

$pH=-\log[H^+]$

where,

$[H^+]=\frac{0.0042mol}{0.05741L}=0.0731M$

Putting values in above equation, we get:

$pH=-\log(0.0731)\\\\pH=1.136$

Hence, the pH of the solution is 1.136

8 0

3 years ago

When zinc and HCl are reacted, the product is hydrogen gas. You can measure the reaction rate by measuring what?

Zarrin [17]

Answer:

measuring the consumption of the products and the rate of conversion of products to reagents

Explanation:

It must be taken into account that the reaction rate also depends on the presence of a catalyst, since these advance the rate of the reaction.

6 0

2 years ago

Determine whether the bonds in CCl4 and N2 are polar or non-polar. If the bond is polar, assign the partial positive and negativ

stira [4]

Refer to the attachment

7 0

2 years ago

PLSSSSSSSS help !!!!! One mole of an element contains which of the following?

irina [24]

Answer:

6.02 × 10²³ atoms

Explanation:

The number 6.02 × 10²³ is called Avogadro number. It is the number of atoms, ions and molecules in one gram atoms of an element, one gram ions of substance and one gram molecule of a compound.

For example:

32 g of oxygen = one mole = 6.02 × 10²³ atoms O.

1.008 g of hydrogen = one mole = 6.02 × 10²³ atoms of H.

or

18 g of H₂O =one mole = 6.02 × 10²³ molecules of H₂O

44 g of CO₂ = one mole = 6.02 × 10²³ molecules of CO₂

or

62 g of NO₃⁻ = one mole of NO₃⁻ = 6.02 × 10²³ ions of NO₃⁻

5 0

2 years ago