All categories

4 years ago

Balance the reaction of c6h12o6(s)+o2(g)=co2(g)+h2o(l)

Chemistry

1 answer:

avanturin [10]4 years ago

3 0

6CO2 + 7H2O = C6H12O6 + 6O2 + H2O

Explanation:

CO2 + H2O = C6H12O6 + O2 + H2O

Starting carbon atoms,

1C on reactants and 6C on products,

therefore you should start by putting a 6 on CO2

6CO2 + H2O = C6H12O6 + O2 + H2O

Proceed with Hydrogen,

Reactants → 2H

Products → 14H

You should multiply H2O with 7 .

6CO2 + 7H2O = C6H12O6 + O2 + H2O

the we need to proceed for Oxygen,

Reactants → 12 + 7= 19O

Products → 6 O in C6H12O6, 2O in O2 and 1O in H2O

we need to balance the equation without disrupting the balance of other atoms, so we need to Multiply O2 with 6

The required balanced equation is

6CO2 + 7H2O = C6H12O6 + 6O2 + H2O

You might be interested in

A 5.000 g mixture contains strontium nitrate and potassium bromide. Excess lead(II) nitrate solution is added to precipitate out

scZoUnD [109]

Answer: The mass percent of potassium bromide in the mixture is 9.996%

Explanation:

To calculate the number of moles, we use the equation:

$\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}$ .....(1)

For lead (II) bromide:

Given mass of lead (II) bromide = 0.7822 g

Molar mass of lead (II) bromide = 367 g/mol

Putting values in equation 1, we get:

$\text{Moles of lead (II) bromide}=\frac{0.7822g}{367g/mol}=0.0021mol$

The chemical equation for the reaction of lead (II) nitrate and potassium bromide follows:

$2KBr+Pb(NO_3)_2\rightarrow PbBr_2+2KNO_3$

By Stoichiometry of the reaction:

1 mole of lead (II) bromide is produced from 2 moles of potassium bromide

So, 0.0021 moles of lead (II) bromide will be produced from = $\frac{2}{1}\times 0.0021=0.0042mol$ of potassium bromide

Now, calculating the mass of potassium bromide by using equation 1, we get:

Molar mass of KBr = 119 g/mol

Moles of KBr = 0.0042 moles

Putting values in equation 1, we get:

$0.0042mol=\frac{\text{Mass of KBr}}{119g/mol}\\\\\text{Mass of KBr}=0.4998g$

To calculate the percentage composition of KBr in the mixture, we use the equation:

$\%\text{ composition of KBr}=\frac{\text{Mass of KBr}}{\text{Mass of mixture}}\times 100$

Mass of mixture = 5.000 g

Mass of KBr = 0.4998 g

Putting values in above equation, we get:

$\%\text{ composition of KBr}=\frac{0.4998g}{5.000g}\times 100=9.996\%$

Hence, the percent by mass of KBr in the mixture is 9.996 %

5 0

3 years ago

Many of the stars we see in the night sky are called blue giants. They put out more energy and burn millions of times brighter t

Bumek [7]

Answer:

Because it is closer to earth than the other blue giant stars.

Explanation:

The sun is closer to earth than any other big star which means we see it bigger.

6 0

3 years ago

Why males on average have VO2max than females?

katrin [286]

The average sedentary male will achieve a VO2 max of approximately 35 to 40 mL/Kg/min. And the average sedentary female will score a VO2 max of between 27 an 30 mL/Kg/min.

6 0

3 years ago

The carbon atoms in graphite and the carbon atoms in Diamond have different

Stolb23 [73]

It's the actual structure of diamond which made the two different. Diamonds have a tetrahedral structure, and as for graphite, it's not structured in that way. The structures of the two is also the reason why diamond is harder than graphite.

8 0

3 years ago

A carbon molecule that has a different arrangement of atoms is known as a/an

maw [93]

The correct response I believe is A. Isomer. If a carbon molecule possess more than one arrangement of how its atoms can be arranged, those other arrangements are known as isomers.

3 0

3 years ago