All categories

4 years ago

Balance the reaction of c6h12o6(s)+o2(g)=co2(g)+h2o(l)

Chemistry

1 answer:

avanturin [10]4 years ago

3 0

6CO2 + 7H2O = C6H12O6 + 6O2 + H2O

Explanation:

CO2 + H2O = C6H12O6 + O2 + H2O

Starting carbon atoms,

1C on reactants and 6C on products,

therefore you should start by putting a 6 on CO2

6CO2 + H2O = C6H12O6 + O2 + H2O

Proceed with Hydrogen,

Reactants → 2H

Products → 14H

You should multiply H2O with 7 .

6CO2 + 7H2O = C6H12O6 + O2 + H2O

the we need to proceed for Oxygen,

Reactants → 12 + 7= 19O

Products → 6 O in C6H12O6, 2O in O2 and 1O in H2O

we need to balance the equation without disrupting the balance of other atoms, so we need to Multiply O2 with 6

The required balanced equation is

6CO2 + 7H2O = C6H12O6 + 6O2 + H2O

You might be interested in

Describe what is happening within the system when it is at equilibrium in terms of concentrations, reactions that occur, and rea

cestrela7 [59]

Answer:

Describe what is happening within the system when it is at equilibrium in terms of concentrations, reactions that occur, and reaction rates.

Explanation:

The chemical equilibrium state is the state where the rate of forward reaction becomes equal to the rate of backward reaction.

At this stage the change in concentration of reactants becomes equal to the change in concentration of products.

The reaction will never cease.

That is the reason chemical equilibrium is called dynamic equilibrium.

So, forward and backward reactions will be taking place continuously at equal rates.

3 0

3 years ago

Defibe brefily Why do plants produce secondary metabolites?

AleksandrR [38]

Explanation:

Secondary metabolism produces a large number of specialized compounds (estimated 200,000) that do not aid in the growth and development of plants but are required for the plant to survive in its environment. Secondary metabolism is connected to primary metabolism by using building blocks and biosynthetic enzymes derived from primary metabolism. Primary metabolism governs all basic physiological processes that allow a plant to grow and set seeds, by translating the genetic code into proteins, carbohydrates, and amino acids. Specialized compounds from secondary metabolism are essential for communicating with other organisms in mutualistic (e.g. attraction of beneficial organisms such as pollinators) or antagonistic interactions (e.g. deterrent against herbivores and pathogens). They further assist in coping with abiotic stress such as increased UV-radiation. The broad functional spectrum of specialized metabolism is still not fully understood. In any case, a good balance between products of primary and secondary metabolism is best for a plant’s optimal growth and development as well as for its effective coping with often changing environmental conditions. Well known specialized compounds include alkaloids, polyphenols including flavonoids, and terpenoids. Humans use many of these compounds for culinary, medicinal and nutraceutical purposes.

I hope it's helpful!!

7 0

3 years ago

molecules with a plane of symmetry between the chiral centers are achiral and meso. identify which of the following molecules ar

maks197457 [2]

Molecules with a plane of symmetry between the chiral centers are achiral and meso. From the given molecules (Picture attached) only (A) compound 1 is meso.

When compounds possess a plane of symmetry between the chiral centers they are called achiral or meso compounds. Among the given compounds (A) compound 1 have a plane of symmetry. So we can say compound one is a meso or achiral compound. Compounds two, three, and four have no plane of symmetry, as you can see in the structures attached. So all other compounds (compound 2, compound 3, and compound 4) except compound one are not meso or achiral.

You can also learn about meso compounds from the following question:

brainly.com/question/29022658

#SPJ4

7 0

1 year ago

How many grams of Aspirin (acetylsalicylic acid) should we form in this reaction if we started with 2.08g of Salicyclic Acid?

Kamila [148]

Taking into account the reaction stoichiometry, 2.713 grams of aspirin are formed when 2.08 grams of salicyclic acid reacts.

<h3>Reaction stoichiometry</h3>

In first place, the balanced reaction is:

C₄H₆O₃ + C₇H₆O₃ (Salicyclic Acid) →C₉H₈O₄ (aspirin) + C₂H₄O₂

By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:

C₄H₆O₃: 1 mole
C₇H₆O₃: 1 mole
C₉H₈O₄: 1 mole
C₂H₄O₂: 1 mole

The molar mass of the compounds is:

C₄H₆O₃: 102 g/mole
C₇H₆O₃: 138 g/mole
C₉H₈O₄: 180 g/mole
C₂H₄O₂: 60 g/mole

Then, by reaction stoichiometry, the following mass quantities of each compound participate in the reaction:

C₄H₆O₃: 1 mole ×102 g/mole= 102 grams
C₇H₆O₃: 1 mole ×138 g/mole= 138 grams
C₉H₈O₄: 1 mole ×180 g/mole= 180 grams
C₂H₄O₂: 1 mole ×60 g/mole= 60 grams

<h3>Mass of aspirin formed</h3>

The following rule of three can be applied: if by reaction stoichiometry 138 grams of salicyclic acid form 180 grams of aspirin, 2.08 grams of salicyclic acid form how much mass of aspirin?

$mass of aspirin=\frac{2.08 grams of salicyclic acidx 180 grams of aspirin}{138 grams of salicyclic acid}$