When something burns it usually means something is being damaged or being changed such as colour, smell, or shape.
Respiration:
Glucose + oxygen ----> <u>Carbon dioxide + water (+energy)
</u>C6H12O6 + 6O2 ----> <u>6CO2 + 6H2O (+energy)</u>
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Number of delocalized electrons
Explanation:
Magnesium has more delocalized electrons compared to sodium and this accounts for the higher melting point.
- When magnesium atoms comes together to form a metallic bonds, they have more network of delocalized electrons.
- There is more pull for the localized electrons due to the nuclear charge on the nucleus.
- This strong intermolecular metallic bond increases the melting point of magnesium.
