Answer:
Fiber optics is the technology used to transmit information as pulses of light through strands of fiber made of glass or plastic over long distances.
Explanation:
I did a test on it before
Answer:
The nswer to the question is
The maximum fraction of the air in the room that could be displaced by the gaseous nitrogen is 0.548 or 54.8 %
Explanation:
To solve the question we note that
The density of the liquid nitrogen = 0.808g/mL and the volume is 195 L tank (vaporised)
Therefore since density = mass/volume we have
mass = Density × volume = 0.808 g/mL × 195 L × 1000 ml/L =157560 g
In gaseous form the liquid nitrogen density =1.15 g/L
That is density = mass/volume and volume = mass/density = 157560 g/(1.15g/L) or
volume = 137008.69565 L
The dimension of the room = 10 m × 10 m × 2.5 m = 250 m³ and
1 m³ is equivalent to 1000 L, therefore 250 m³ = 250 m³ × 1000 L/m³ = 250000L
Therefore fraction of the volume occupied by the gaseous nitrogen =
137008.69565 L/250000 L = 0.548
Therefore the gaseous nitrogen occpies 54.8% of the room
Answer:
A small still is separating propane and butane at 135 °C, and initially contains 10 kg moles of a mixture whose composition is x = 0.3 (x = mole fraction butane). Additional mixture (x = 0.3) is fed at the rate of 5 kg mole/hr. The total volume of the liquid in the still is constant, and the concentration of the vapor from the still (xp) is related to x, as follows: Xp = How long will it take for X, to change from 0.3 to 0.35.
The moving of molecules from areas of high concentration to that of low concentration to gain energy is best described as passive transport
<h3>What is passive transport?</h3>
Passive transport is a type of membrane transport in which chemicals are moved across cell membranes without using energy. Unlike active transport, which uses cellular energy, passive transport uses the second law of thermodynamics to cause the movement of substances across cell membranes.
<h3>Why is passive transport important?</h3>
Passive transport processes are critical to homeostasis. They maintain proper conditions inside the cell and the organism as a whole by letting chemicals to pass into and out of the cell.
To know more about Passive transport visit:
brainly.com/question/13542102
#SPJ4
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
