Answer:
The correct answer is option b, that is, the radioactive isotope reacts in the same way as stable isotopes in the chemical reactions in the body.
Explanation:
The carbon-14 atoms, which are created by the cosmic rays associates with oxygen to produce carbon dioxide that plants captivate naturally and comprise it into plant fibers by the process of photosynthesis. Afterward, the plants are consumed by animals and human beings, thus, they take in carbon-14 as well.
The ratio of usual carbon-12 to carbon-14 in the air and in all the living species at a particular period is almost the same. These radioactive isotopes react in a similar manner as stable isotopes in the chemical reactions in the body.
Answer:
D. The data supported the hypothesis
Explanation:
The data shows that rats fed a normal diet with the addition of vitamins gained a higher average weight gain in the period of 3 months, compared to rats fed a normal diet. This supports the scientists' hypothesis of "Young rats that had vitamins added to their food would gain weight faster than young rats fed a normal diet."
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
double replacement
Explanation:
The reaction equation is given as:
Pb(NO₃)₂ + 2KI → PbI₂ + KNO₃
This reaction is a double displacement reaction.
In this form of reaction, there is an actual exchange of partners to form new compounds.
AB + CD → AD + CD
One of the following condition serves as driving force for the reaction:
- formation of an insoluble compound
- formation of water or any other non-ionizing compound
- liberation of a gaseous product.
Answer:
The new volume will be 367mL
Explanation:
Using PV = nRT
V1 = 259mL = 0.000259L
n1 = 0.552moles
At constant temperature and pressure, the value is
P * 0.000259 = 0.552 * RT ------equation 1
= 0.552 / 0.000259
= 2131.274
V2 = ?
n2 = 0.552 + 0.232
n2 = 0.784mole
Using ideal gas equation,
PV = nRT
P * V2 = 0.784 * RT ---------- equation 2
Combining equations 1 and 2 we have;
V2 = 0.784 / 2131.274
V2 = 0.000367L
V2 = 367mL
