Answer:
negative
Explanation:
When something slows down, its acceleration is the opposite of the velocity.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
13.20 cm/s is the rate at which the water level is rising when the water level is 4 cm.
Explanation:
Length of the base = l
Width of the base = w
Height of the pyramid = h
Volume of the pyramid = 
We have:
Rate at which water is filled in cube = 
Square based pyramid:
l = 6 cm, w = 6 cm, h = 13 cm
Volume of the square based pyramid = V





Differentiating V with respect to dt:




Putting, h = 4 cm


13.20 cm/s is the rate at which the water level is rising when the water level is 4 cm.
Molar mass SiO2 = 28 + 32 = 60
<span>so moles sand = 3.4 x 10-7 / 60</span>
Answer:
Real gas particles have significant volume
Real gas particles have more complex interactions than ideal gas particles.
Explanation:
An ideal gas is an imaginary concept and a gas behaves almost ideally at certain pressure and temperature conditions.
The gas in real deviates from the ideal behavior as some of the assumptions made for ideal gases are not true in case of real gases.
Real gas particles have significant volume as compared to vessel unlike ideal gases.
There are interactions present in between real gas molecules at high pressure conditions.