Answer:
2) Copper (II) Chloride
Explanation:
A precipitate will form if the resulting compound is insoluble in water. For example, a silver nitrate solution (AgNO3) is mixed with a solution of magnesium bromide (MgBr2).
Explanation:
Metals are the species which readily lose electrons in order to attain stability. This electron lost by the atom is actually present in its outermost shell which is also known as valence shell.
Ionization energy is defined as the energy required to remove the most loosely bound electron from a neutral gaseous atom.
When we move across a period from left to right then there occurs a decrease in atomic size of the atoms. Therefore, ionization energy increases along a period.
But when we move down a group then there occurs an increase in atomic size of the atoms due to addition of number of electrons in the atoms. Hence, ionization energy decreases along a group.
Thus, we can conclude that metals have low ionization energies and readily share their valence or outer electrons with each other to form an electron sea. These electrons are delocalized or shared among all the atoms that are bonded together and can therefore move freely throughout the metal structure.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
Mass = 1.33 g
Explanation:
Given data:
Mass of argon required = ?
Volume of bulb = 0.745 L
Temperature and pressure = standard
Solution:
We will calculate the number of moles of argon first.
Formula:
PV = nRT
R = general gas constant = 0.0821 atm.L/mol.K
By putting values,
1 atm ×0.745 L = n × 0.0821 atm.L/mol.K× 273.15 K
0.745 atm. L = n × 22.43 atm.L/mol
n = 0.745 atm. L / 22.43 atm.L/mol
n = 0.0332 mol
Mass of argon:
Mass = number of moles × molar mass
Mass = 0.0332 mol × 39.95 g/mol
Mass = 1.33 g
Answer:
Types of Potential Energy
Elastic Potential Energy. Anything that can act like a spring or a rubber band can have elastic potential energy. ...
Gravitational Potential Energy. There is a constant attractive force between the Earth and everything surrounding it, due to gravity. ...
Chemical Potential Energy.
(IF THIS HELPED CAN YOU GIVE ME A BRAINYLEST PLEASE?)
