Answer:
18 grams of water
Explanation:
The Balance Chemical Reaction is as follow,
2 NH₄NO₃ → 2 N₂ + O₂ + 4 H₂O
According to Equation,
160 g (2 moles) NH₄NO₃ produces = 72 g (4 moles) of H₂O
So,
40 g of NH₄NO₃ will produce = X g of H₂O
Solving for X,
X = (40 g × 72 g) ÷ 160 g
X = 18 g of H₂O
<em>Hope This Helps!</em>
Answer:
By the result of the formation of positive and negative ions, Ionic compounds are formed.
Explanation:
Electrons are actually transferred from one atom to another to form rare gas electron structures for each ion. The atom which forms a positive ion loses electrons to the atom which gains electrons to form a negative ion. A compound is not stable unless the number of electrons which are lost and gained are equal
Explanation:
Equation for Calcium Hydroxide Dissolving in Water | Ca(OH)2 + H2O
Answer:
6 moles of oxygen
Explanation:We can find from the chemistry equation
C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)
6 moles O2 ~4 moles H2O
Answer : The volume of 1 M NaOH solution required are, 400 mL
Explanation :
To calculate the volume of base, we use the equation given by neutralization reaction:
where,
are the n-factor, molarity and volume of acid which is 
are the n-factor, molarity and volume of base which is NaOH.
We are given:
Putting values in above equation, we get:
Therefore, the volume of 1 M NaOH solution required are, 400 mL
