Determine the value of the equilibrium constant, KgoalKgoalK_goal, for the reaction CO2(g)⇌C(s)+O2(g)CO2(g)⇌C(s)+O2(g), Kgoal=?
Kgoal=? by making use of the following information: 1. 2CO2(g)+2H2O(l)⇌CH3COOH(l)+2O2(g)2CO2(g)+2H2O(l)⇌CH3COOH(l)+2O2(g), K1 = K1 = 5.40×10−165.40×10−16 2. 2H2(g)+O2(g)⇌2H2O(l)2H2(g)+O2(g)⇌2H2O(l), K2 = K2 = 1.06×10101.06×1010 3. CH3COOH(l)⇌2C(s)+2H2(g)+O2(g)CH3COOH(l)⇌2C(s)+2H2(g)+O2(g), K3 = K3 = 2.68×10−92.68×10−9
There will be more collisions and so a greater pressure. The number of particles is proportional to pressure, if the volume of the container and the temperature remain constant. ... Volume is inversely proportional to pressure, if the number of particles and the temperature are constant.