Answer is: an instant ice pack becoming cold, splitting a gas molecule and baking bread.
<span>Endothermic reaction
is chemical reaction that absorbs more energy than it releases.
</span>In ice pack, <span>reaction absorbs heat from the surroundings (endothermic reaction), lowering the surrounding temperature.
For splitting molecule and baking bread we must add energy to break bonds between atoms.</span>
Consider you have a mixture of amino acids(contains all set of amino acids such as polar, non polar). Other than TLC, how are you supposed to separate a single amino acid from the mixture without loss of amino acid quantitatively.
Answer:
25.7 mL
Explanation:
Step 1: Given data
- Initial concentration (C₁): 0.350 M
- Final volume (V₂): 600 mL
- Final concentration (C₂): 0.150 M
Step 2: Calculate the volume of the initial solution
We have a concentrated solution and we want to prepare a diluted one. We can calculate the initial volume using the dilution rule.
C₁ × V₁ = C₂ × V₂
V₁ = C₂ × V₂ / C₁
V₁ = 0.150 M × 600 mL / 0.350 M
V₁ = 25.7 mL
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
