The conclusion that would support the students prediction is B) Plant "A" grows taller than Plant "B".
If the student thinks that adding fertilizer to the plant would help it grow then answer B) would make the most sence.
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
I might need a diagram for this, but I have a vague idea of what you are talking about.
If H20 is going left it means the temperature is going lower.
The molecules will condense to slowly become ice
True because its still technically the same substance
Answer:
I was jumping on an trampoline and my sisters hare and mine started floating up from the static electricity
