Answer:
Distillation
Explanation:
Distillation is the process of separating the components of a liquid by using the method of selective boiling and condensation.
Since the components of the liquid have different boiling points, they would evaporate at different temperatures, thus causing the separation to occur.
So, distillation can be used to separate a mixture of milk and water.
Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
Answer:
option A
There will be no effect in the freezing point of water.
Answer:You didn't provide examples
Explanation: Groundwater can cause erosion under the surface as it moves through the soil. During the movement an acid is formed which what causes erosion and deposition.
Hope that helps
Answer:
The mass of glycerol that the student should weigh out depends on the volume that is needed. For example, the density of glycerol is 1.26 g/mL. Then, if 500 mL of glycerol is needed, 630 g should be weighed.
Explanation:
Density is the amount of mass per unit of volume. Density relates how many grams 1 milliliter of a substance weighs. Thus, if the density of glycerol is 1.26 g/mL means that 1.26 grams of glycerol occupy 1 mL of volume, or, in other words, 1 mL of glycerol weighs 1.26 grams.
Therefore, if 500 mL of glycerol is required to use for an experiment, 630 grams need to be weighed:
1 mL glycerol________ 1.26 g
500 mL glycerol______ x= 500mL * 1.26 g / 1 mL = 630 g
