The correct answer is A. cloud of gases that forms around the nucleus of a comet is called a coma. The coma is a dusty, fuzzy cloud around the nucleus of a comet. Other parts of a comet are the nucleus and the tail.
Answer:
The red blood cells will burst
Explanation:
When the red blood cells are placed in pure water, they will gain water by osmosis, swell and finally burst due to their weak cell membranes. This process is referred to as hemolysis.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
A catalyst is when a chemical reaction occurs faster than normal.
The system is unaffected during a catalyst because both forward and reverse reactions are affected, meaning that quilibrium will occur faster nothing will change.
Hope it helped,
BioTeacher101