Answer:
The elements in the periodic table are arranged in order of increasing atomic number.
Explanation:
Answer:
Correct option -D
Explanation:
Here, A kinetics experiment is set up is set up to collect the gas that is generated from the cacarbonate and methanoic acid.
Among the given conditions, decreasing the particle size of calcium carbonate only increases the production of gas.
Smaller particles of reactant increases the surface area then followed by rate of reaction will be increases it leads to increases the production of gas.
Therefore, the suitable experimental condition most likely to increase the gas production is-
Decreasing the particle size of the
by grinding it into a fine powder.
Hence, correct option -D.
Answer:
The ion is written in the attached file
Explanation:
Answer:
6 moles of oxygen
Explanation:We can find from the chemistry equation
C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)
6 moles O2 ~4 moles H2O
Answer:
V₂ = 1.41 L
Explanation:
Given data:
Initial temperature = 35°C (35 +273.15 K = 308.15 K)
Initial volume = 1.5 L
Final temperature = 17°C (17+273.15 K = 290.15 K)
Final volume = ?
Solution:
The given problem will be solve through the Charles Law.
According to this law, The volume of given amount of a gas is directly proportional to its temperature at constant number of moles and pressure.
Mathematical expression:
V₁/T₁ = V₂/T₂
V₁ = Initial volume
T₁ = Initial temperature
V₂ = Final volume
T₂ = Final temperature
Now we will put the values in formula.
V₁/T₁ = V₂/T₂
V₂ = V₁T₂/T₁
V₂ = 1.5 L × 290.15 K / 308.15 k
V₂ = 435.23 L.K / 308.15 k
V₂ = 1.41 L