Answer: Option (b) is the correct answer.
Explanation:
A covalent compound is defined as the compound in which sharing of electrons take place between the combining atoms. Generally, when two or more non-metals chemically combine together the it will lead to the formation of a covalent compound.
For example, 
and HCl is also a covalent compound.
And, a compound in which transfer of electrons occur between the combining atoms is known as an ionic compound. Whenever, a metal chemically combines with a non-metal then it will always lead to the formation of an ionic compound.
For example, KI is an ionic compound.
Thus, we can conclude that and HCl are the two substances which are covalent compounds.
Explanation:
Equiv means equivalent ...
Answer:
The correct answer is: Dynamic equilibrium in a chemical reaction is the condition in which the rate of the forward reaction equals the rate of the reverse reaction.
Explanation:
Dynamic equilibrium is a chemical equilibrium between froward reaction and backward or reverse reaction where rate of reaction going forwards is equal to the rate of reaction going backward (reverse).
Some other properties of dynamic equilibrium are:
- Chemical equilibrium are attained is closed system.
- The macroscopic remains constant like: volume, pressure, energy etc.
- The concentration of the reactants and products remain constant.They are not always equal.
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Hey there!:
Volume = 175.4 mL
density = 0.8786 g/mL
mass = ?
Therefore:
D = m / V
0.8786 = m / 175.4
m = 0.8786 * 175.4
m = 154.10644 g
hope this helps!
