All categories

3 years ago

All of the following methods would increase the solubility of a solid solute, except for

Chemistry

2 answers:

ikadub [295]3 years ago

5 0

B: stiring the particles more vigorously

Goryan [66]3 years ago

3 0

C-Turning the heat down Hope this helps! :)

You might be interested in

Who is considered the founder of the periodic table of the elements?

nata0808 [166]

Answer:

Dmitry Mendeleev

Explanation:

Around 1869 a Russian scientist, Dmitry Mendeleev formed what is now known as the periodic table or chart. The Mendeleevian periodic table was based on the atomic weights of elements using the periodic law. The periodic law states that "chemical properties of elements are a periodic function of their atomic weights".

The modern periodic table was re-stated by Henry Moseley in the 1900s. He changed the basis of the periodic law to atomic masses.

7 0

2 years ago

A plant extract can be obtained with organic solvents such as acetone or ethyl alcohol, and is composed of plant pigments such a

prohojiy [21]

Answer:

Here's what I get

Explanation:

A plant extract is a mixture because it contains different substances: acetone or ethanol, chlorophylls A and B, carotene and xanthophylls.

It is homogeneous because it is a solution. There is only one phase: the liquid phase. You cannot see the pigments as separate phases.

You can separate the pigments by paper, thin layer, or column chromatography.

Many schools use paper chromatography, because paper is cheap.

As the mixture of pigments follows the solvent up the paper, they separate into different coloured bands according to their attractive forces to the cellulose in the paper.

The chlorophylls are strongly attracted to the paper, so they don't travel very far.

The nonpolar carotene molecules have little attraction to the polar cellulose, so they are carried along by the solvent front.

8 0

3 years ago

Exercise A mixture of 250 mL of methane, CH4, at 35 °C and 0.55 atm and 750 mL of propane, C3Hg, at 35° C and 1.5 atm, were intr

dalvyx [7]

Explanation:

The given data is as follows.

$V_{1}$ = 250 mL, $V_{2}$ = 750 mL

$T_{1}$ = $35^{o}C$ = 35 + 273 K = 308 K

$T_{2}$ = 35 + 273 K = 308 K

$P_{1}$ = 0.55 atm, $P_{2}$ = 1.5 atm

P = ? , V = 10.0 L

Since, temperature is constant.

So, $P_{1}V_{1} + P_{2}V_{2}$ = PV

Now, putting the given values into the above formula as follows.

$P_{1}V_{1} + P_{2}V_{2}$ = PV

$0.55 atm \times 250 mL + 1.5 atm \times 1.5 atm$ = $P \times 10.0 L$

P = 0.126 atm

As, 1 atm = 760 torr. So, $0.126 atm \times \frac{760 torr}{1 atm}$ = 95.76 torr.

Thus, we can conclude that the final pressure, in torr, of the mixture is 95.76 torr.

8 0

2 years ago

Balance this equation Pb(NO3)2+Na2(CrO4)=Pb(CtO4)+Na(NO3)

zzz [600]

I'm guessing you mean Cr (Chromium) in the product instead of Ct.

Pb(NO3)2 + Na2(CrO4) = Pb(CtO4) + 2Na(NO3)

3 0

3 years ago

If a little old lady is doing 98.3 kilometers/hour, will she get a speeding ticket if the speed limit is 55 miles / hour? [USE:

shutvik [7]

Answer:

It is possible she could get one.

Explanation:

To solve this problem we need to convert 98.3 kilometers/hour to miles/hour.

In other words, we convert km to mi, to do so we multiply 98.3 km by a conversion factor, putting the unit we want to have in the numerator, and the unit we want to convert in the denominator:

98.3 km * $\frac{1000m}{1km} *\frac{100cm}{1m}*\frac{1in}{2.54cm} *\frac{1ft}{12in} *\frac{1mi}{5280ft}$ = 61 mi

Given that the little old lady is doing 61 miles/hour, she could get a speeding ticket.

7 0

3 years ago