Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
(A) Naoh + Hno3 == Nano3 + h20.
and it is acid based reaction.
(B) H + Br == Hbr. it is synthesis reaction
and it should be hydrogen gas with bromine gas if that was question then
H2 + Br2 == 2Hbr
(c) 3Agno3 + Alcl3 == Al (No3)3 + 3Agcl
it is double displacement. and we right the polyatomic ion in bracket that’s why no3 is in bracket.
please let me know if you need something
Actually Welcome to the Concept of the Ionic bonds.
Since Sodium (Na) is a cation and Chlorine (Cl) is a Anion, they both form a Ionic bond called as NaCl (common salt)
So answer is, Na and Cl
The product will not be affected by the addition of twice as much Na₂CO₃.
<h3>What is Limiting reagent in stoichiometry ?</h3>
- The maximum quantity of the end product determined by a balanced chemical equation is known as the Stoichiometry.
- The limiting reactant is the one that is consumed first and sets a limit on the quantity of product(s) that can be produced, and the one which remains unconsumed after the final reaction is in Excess.
- Calculate the moles of each reactant present and contrast it with the mole ratio of the reactants in the balanced equation to determine which reactant is the limiting one.
Here,taking the stoichiometry into consideration, we find that the reaction happens with 1:1 ratio; so, adding twice the amount of Na₂CO₃ will lead to its excess making the other the limiting reactant, hence, it would not affect the yield of the product.
To know more about the Limiting reactant, refer to:
brainly.com/question/14222359
#SPJ4
