Question

Convert the condensed structures to line angle formulas: 1. CH3CH2CH(CH3)CH2CH3 8. CH:COCH 9. CH3CH2OCH3 2. CH3CH2CH(CH2CH3)CH(CH3)CH2CHO CH)CH:CH-CH: 10. CH CH2CH=C(CH:CH)(C(CH))CH 3. CH3CH2CH(CH3)CH(CH3)CH2CH3 11. CH:CH-CH(CH2CH)CH OH 4. CH3C(CH3)2CH2CH2CH(CH3)CH2CH3 12. CHCHOCH2CHO 5. CH(CH3)2CH(CI)CH2CH3 13. HOOCCH2NHCH(CH3)COCH; 6. CH3CH2CHOCH(CH2CH3)CH2CH3 14. HOOCCH OCH COOH 7. HOCH:C(CH3)2CONH2

Answer 1

Answer:

Attached in the photo.

Explanation:

Hello,

The answers in the attached photo. Just three things:

- In the second point a parenthesis is missing to properly understand the molecule (after the oxygen), nevertheless, I assumed it was an ether.

- In the sixth point, there's a missing hydrogen for it to be an ether as well.

- In the tenth point the second parenthesis is not clear, it seems there's a missing subscript, nevertheless I draw it assuming complete octates.

Best regards.