<span>Persamaan setara pada reaksi besi dengan asam klorida membentuk besi (II) klorida dan gas hidrogen
</span>
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Glucose is carbohydrate and a simple sugar that is very important to the human body.
Energy is produced for the cells in the body through the process of metabolism which oxidizes glucose to water, carbon dioxide, and some nitrogen compounds.
The general chemical reaction equation for metabolism is:
C6H12O6 + 6O2 ---> 6CO2 + 6H2O
The empirical formula of a compound found to have 55.7% hafnium and 44.3% chlorine is HfCl4.
<h3>How to calculate empirical formula?</h3>
The empirical formula of a compound is a notation indicating the ratios of the various elements present in a compound, without regard to the actual numbers.
The empirical formula of the given compound can be calculated as follows:
- Hafnium = 55.7% = 55.7g
- Chlorine = 44.3% = 44.3g
First, we convert mass values to moles by dividing by the molar mass of each element
- Hafnium = 55.7g ÷ 178.49g/mol = 0.312mol
- Chlorine = 44.3g ÷ 35.5g/mol = 1.25mol
Next, we divide each mole value by the smallest
- Hafnium = 0.312 ÷ 0.312 = 1
- Chlorine = 1.25 ÷ 0.312 = 4
Therefore, the empirical formula of a compound found to have 55.7% hafnium and 44.3% chlorine is HfCl4.
Learn more about empirical formula at: brainly.com/question/14044066
#SPJ1
