Answer:

Explanation:
The heat received by water is equal to the heat rejected by the piece of metal. That is to say:



The initial temperature of the piece of metal is:

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
D. Same energy level but different sublevel.
<h3>Explanation</h3>
There are four quantum numbers [1]:
- <em>n</em><em>, </em>the principal quantum number,
- <em>l</em>, the orbital angular momentum quantum number,
- <em>
</em>, the magnetic quantum number, and - <em>
</em>, the electron spin quantum number.
As their names might suggest:
- <em>n </em>determines the main energy level of an electron.
- <em>l</em> determines the type of sublevel of an electron.
- Each sublevel might contain more than one orbital. <em>
</em> gives the orbital of an electron. - Each orbital contains up to two electrons. <em>
</em> tells two electrons in the same orbital apart.<em> </em>
The two electrons in question come from the same atom. The question suggests that they have the same <em>n</em>, <em>
</em>, and <em>
</em>. As a result, both electrons are in main energy level <em>n</em> = 3. They share the same spin.
However, the two electrons differ in their value of <em>l</em>.
- <em>l </em>= 2 for the first electron. It belongs to a <em>d</em> sublevel.
- <em>l </em>= 1 for the second electron. It belongs to a <em>p</em> sublevel.
<h3>Reference</h3>
[1] Kamenko, Anastasiya, et. al, "Quantum Numbers", Physical & Theoretical Chemistry, Chemistry Libretexts, 24 Mar 2017.
The reaction between hydrogen and oxygen to form water is given as:

The balanced reaction is:

According to the balanced reaction,
4 g of hydrogen (
) reacts with 32 g of oxygen (
).
So, oxygen reacted with 29.4 g of hydrogen is:

Hence, the mass of oxygen that is reacted with 29.4 g of hydrogen is 235.2 g.