CaCl2 and KCl are both salts which dissociate in water
when dissolved. Assuming that the dissolution of the two salts are 100 percent,
the half reactions are:
<span>CaCl2 ---> Ca2+ + 2 Cl-</span>
KCl ---> K+ + Cl-
Therefore the total Cl- ion concentration would be coming
from both salts. First, we calculate the Cl- from each salt by using stoichiometric
ratio:
Cl- from CaCl2 = (0.2 moles CaCl2/ L) (0.25 L) (2 moles
Cl / 1 mole CaCl2)
Cl- from CaCl2 = 0.1 moles
Cl- from KCl = (0.4 moles KCl/ L) (0.25 L) (1 mole Cl / 1
mole KCl)
Cl- from KCl = 0.1 moles
Therefore the final concentration of Cl- in the solution
mixture is:
Cl- = (0.1 moles + 0.1 moles) / (0.25 L + 0.25 L)
Cl- = 0.2 moles / 0.5 moles
<span>Cl- = 0.4 moles (ANSWER)</span>
Answer:
Hello There!!
Explanation:
I believe the answer is c. Volume of the dilute solution is 100.00 mL.
hope this helps,have a great day!!
~Pinky~
We can use the atomic model to demonstrate the ways in which scientists
refine and build off each other's findings because of the fact that once
this model was created, it brought with it other models and inventions,
such as the periodic table and other theories about our known universe.
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
