The answer is both B and C
positive chromic acid test is indicated by disappearance of orange colour from chromic ions and appearance of blue-green color from Chromium (iii) ion (reduction of chromium ion from CrO4 - to Cr3+)
positive chromic test indicated functional groups that can be oxidized.
cyclohexanol can be oxidized to become cyclohexanone
and pentan-3-ol can be oxidized to become pentan-3-one
hence both B and C will show positive chromic acid test
A) tert butanol although contains alcohol functional group, cannot be further oxidized as it is a tertiary alcohol
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
1. 80g
2. 1.188mole
Explanation:
1. We'll begin by obtaining the molar mass of CH4. This is illustrated below:
Molar Mass of CH4 = 12 + (4x1) = 12 + 4 = 16g/mol
Number of mole of CH4 from the question = 5 moles
Mass of CH4 =?
Mass = number of mole x molar Mass
Mass of CH4 = 5 x 16
Mass of CH4 = 80g
2. Mass of O2 from the question = 38g
Molar Mass of O2 = 16x2 = 32g/mol
Number of mole O2 =?
Number of mole = Mass /Molar Mass
Number of mole of O2 = 38/32
Number of mole of O2 = 1.188mole
Answer:
Avogadro number of representatives particles is equal to one mole.
Explanation:
The number 6.022 × 10²³ is called Avogadro number.
It is the number of atoms , ions and molecules in one gram atom of element, one gram molecules of compound and one gram ions of a substance.
For example,
18 g of water = 1 mole = 6.022 × 10²³ molecules of water
17 g of ammonia = 1 mole = 6.022 × 10²³ molecules of ammonia
12 g of carbon = 1 mole = 6.022 × 10²³ atoms of carbon
1.008 g of hydrogen = 1 mole = 6.022 × 10²³ atoms of hydrogen
