Answer:
capacity factor = 0.952
Availability factor = 0.958
Explanation:
1) capacity factor
capacity factor = actual power output / maximum power output
= (actual power output)/(efficiency * rated power output)
= 0.952
2) Availability factor
Availability factor = Actual operation time period/ total time period
= 23/24 = 0.958
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
ΔHr = -103,4 kcal/mol
Explanation:
<u>Using:</u>
<u>AH° (kcal/mol)
</u>
<u>Metano (CH)
</u>
<u>-17,9
</u>
<u>Cloro (CI)
</u>
<u>tetraclorometano (CCI)
</u>
<u>- 33,3
</u>
<u>Acido cloridrico (HCI)
</u>
<u>-22</u>
It is possible to obtain the ΔH of a reaction from ΔH's of formation for each compound, thus:
ΔHr = (ΔH products - ΔH reactants)
For the reaction:
CH₄(g) + Cl₂(g) → CCl₄(g) + HCl(g)
The balanced reaction is:
CH₄(g) + 4Cl₂(g) → CCl₄(g) + 4HCl(g)
The ΔH's of formation for these compounds are:
ΔH CH₄(g): -17,9 kcal/mol
ΔH Cl₂(g): 0 kcal/mol
ΔH CCl₄(g): -33,3 kcal/mol
ΔH HCl(g): -22 kcal/mol
The ΔHr is:
-33,3 kcal/mol × 1 mol + -22 kcal/mol× 4 mol - (-17,9 kcal/mol × 1 mol + 0kcal/mol × 4mol)
<em>ΔHr = -103,4 kcal/mol</em>
<em></em>
I hope it helps!
The answer is D. oversaturated. The term to represent the solution contains more solid solute than saturated solution is supersaturated, not oversaturated.
When collecting gas over water, the gas is always a mixture of the gas collected and water vapor. This statement is true.
The gaseous phase of water is known as water vapor or aqueous vapor. Within the hydrosphere, it is one type of water state. Water vapor can be created by the boiling or evaporation of liquid water as well as by the sublimation of ice. Like the majority of other atmospheric elements, water vapor is transparent. The mist that hovers above a saucepan of boiling water is an illustration of water vapor.
Gaseous water, particularly when it is distributed in the atmosphere. Steam. The most frequent greenhouse gas is water vapor. It contributes to around half of the planet's warming. It absorbs heat that is projected upward from the earth while letting practically all sunlight reach the planet's surface like other greenhouse gases do.
To learn more about water vapor please visit -
brainly.com/question/20899075
#SPJ4
