Answer: What is the mass, in grams, of 135 mL of ethanol? d=0.789 g/mL - the ethanol density. V=135 mL - the volume of ethanol. m=0.789g/mL*135mL=106.515g ~ 106.5g- the mass of ethanol.
Explanation:
Hope this helps :)
Answer:
The enthalpy of the solution is -35.9 kJ/mol
Explanation:
<u>Step 1:</u> Data given
Mass of lithiumchloride = 3.00 grams
Volume of water = 100 mL
Change in temperature = 6.09 °C
<u>Step 2:</u> Calculate mass of water
Mass of water = 1g/mL * 100 mL = 100 grams
<u>Step 3:</u> Calculate heat
q = m*c*ΔT
with m = the mass of water = 100 grams
with c = the heat capacity = 4.184 J/g°C
with ΔT = the chgange in temperature = 6.09 °C
q = 100 grams * 4.184 J/g°C * 6.09 °C
q =2548.1 J
<u>Step 4:</u> Calculate moles lithiumchloride
Moles LiCl = mass LiCl / Molar mass LiCl
Moles LiCl = 3 grams / 42.394 g/mol
Moles LiCl = 0.071 moles
<u>Step 5:</u> Calculate enthalpy of solution
ΔH = 2548.1 J /0.071 moles
ΔH = 35888.7 J/mol = 35.9 kJ/mol (negative because it's exothermic)
The enthalpy of the solution is -35.9 kJ/mol
Answer:
MgCl2 + 2AgNO3 → 2AgCl + Mg(NO3)2
Explanation:
I'm assuming you want to balance it so...
The first thing I see is that there are two chlorines on the reactant side and one on the product side
Adding a coefficient of 2 would get 2AgCl2
Now there are two silvers on the reactant side, so add a 2 to AgNO3 on the products side. Now they are all balanced.
If that is not what you are looking for let me know!
When a solid turns into a liquid
Example: Ice cube melts into water
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3