Answer:
It favors the forward reaction.
Explanation:
According to Le Chatelier's Principle, when a system at equilibrium suffers a perturbation, the system will react in order to counteract the effect of such perturbation.
If more reactant is added, the system will try to decrease its concentration. It will do so by favoring the forward reaction, decreasing the concentration of the reactant and increasing the concentration of the products, in order to re-establish the equilibrium.
A large atom means that the radius would be large, meaning that the effective nuclear charge is low, therefore a lower electronegativity based on the periodic table. A smaller atom would mean the opposite, therefore a higher electronegativity. This combination would mean that the new molecule is polar.
Also, to answer your question, it would be most likely different from both atoms, as size doesn't really matter in a compound's properties.
Molar mass (CaCl2) = 40.1 +2*35.5 = 111.1 g/mol
Molar mass (AlCl3) = 27.0 +3*35.5= 133.5 g/ mol
3CaCl2+Al2O3 -------->3CaO +2AlCl3
mole from reaction 3 mol 2 mol
mass from reaction 3mol* 111.1g/mol 2 mol*133.5g/mol
333.3 g 267.0 g
mass from problem 45.7 g x g
Proportion:
333.3 g CaCl2 ------- 267.0 g AlCl3
45.7 g CaCl2 -------- x g AlCl3
x=45.7*267.0/333.3= 36.6 g AlCl3
<span>rutherfordium element # 104</span>
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
