Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Hello There!
The solution: salt water
Mix: Physical as you could still separate them
A chemical mix can't be reversed.
Hope This Helps You!
Good Luck :)
- Hannah ❤
An atom is the smallest particle of an element that can take part in a chemical reaction.
An atom is made up of energy levels that contain electrons which are negatively charged and the nucleus which contains neutrons and protons that are negatively charge .
Due the positive charge of the nucleus of an atom, an atom always want to attract its electrons and keep them near it however it weakly attracts the other electrons of a nearby atom.
Answer with Explanation:
The units used to express the densities of gases are different from those of solids and liquids because the particles in gas are widely separated from each other, unlike the particles in solid and liquid <u><em>which are almost the same</em></u>. The particles in solid are very close together. Considering it melts (if it's an ice), it will turn into a liquid and the change in volume is slightly greater only. However, if the liquid evaporates and transitions into a gas, <u>the volume becomes largely different from its solid and liquid state</u>. This is because the particles are much farther apart and free to move.
