The first one is Solid, or A.
The second: B or liquids.
Third: also B I think.
Hope this helps.
the fire that destroyed due to the extremely flammable aluminium /iron oxide based applied to the outer skin of the craft. This was struck by lightning and caught fire well before the hydrogen ignited.
Explanation:
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
The intermolecular forces between CO3^2- and H2O molecules are;
1) London dispersion forces
2) ion-dipole interaction
3) hydrogen bonding
Explanation:
Intermolecular forces are forces of attraction that exits between molecules. These forces are weaker in comparison to the intramolecular forces, such as the covalent or ionic bonds between atoms in a molecule.
Considering CO3^2- and H2O, we must remember that hydrogen bonds occur whenever hydrogen is bonded to a highly electronegative atom such as oxygen. The carbonate ion is a hydrogen bond acceptor.
Also, the London dispersion forces are present in all molecules and is the first intermolecular interaction in molecular substance. Lastly, ion-dipole interactions exists between water and the carbonate ion.
Answer:funk
hot dog cat
Explanation:
uhughuhuhuuuuuuuuuuuuuuuuuuuuuuuuuuuuuuuuuuuu
