Answer:
- <u>Cadmium has larger atomic radius than sulfur.</u>
Explanation:
Down a period, atomic radii decrease from left to right due to the increase in the number of protons and electrons across a period: when a proton is added the pull of the electrons towards the nucleus is larger, so the size of the atom decreases.
Hence, you can compare the elements that belong to a same period and predict that the atom with lower atomic number (number of protons) will haver larger atomic radius. With that:
- Oxygen and fluorine are in the period 3, being oxygen to the left of fluorine, so oxygen is larger than fluorine.
- Sulfur and chlorine are in the period 4, being sulfur to the left of chlorine, so sulfur is larger than chlorine.
Now see whan happens down a group. Atomic radius increases from top to bottom within a group due to electron shielding. That permits you to compare the size of the elements in a group:
- Fluorine and chlorine are in the same group (17), with chlorine directly below fluorine, so the atomic radius of chlorine is larger than the atomic radius of fluorine.
- Sulfur and oxygen are in the same group (16), with sulfur directlly below oxygen, so sulfur the atomic radius of sulfur is larger than the atocmi radius of oxygen.
So far, you can rank the atomic radius of sulfur, chlorine, fluorine, and oxygen, in increasing order as:
- O < F < Cl < S, concluding that O, F, and Cl have smaller atomic radius than S.
Cadmiun, Cd, is to the left and below sulfur, so both electron shielding (down a group) and increase of the number of protons (down a period) lead to predict the cadmium has a larger atomic radius than sulfur.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Mass equals density times volume
Because D=m/v
Multiply by v
Dv=m
Answer:-
Carbon
[He] 2s2 2p2
1s2 2s2 2p2.
potassium
[Ar] 4s1.
1s2 2s2 2p6 3s2 3p6 4s1
Explanation:-
For writing the short form of the electronic configuration we look for the nearest noble gas with atomic number less than the element in question. We subtract the atomic number of that noble gas from the atomic number of the element in question.
The extra electrons we then assign normally starting with using the row after the noble gas ends. We write the name of that noble gas in [brackets] and then write the electronic configuration.
For carbon with Z = 6 the nearest noble gas is Helium. It has the atomic number 2. Subtracting 6 – 2 we get 4 electrons. Helium lies in 1st row. Starting with 2, we get 2s2 2p2.
So the short term electronic configuration is [He] 2s2 2p2
Similarly, for potassium with Z = 19 the nearest noble gas is Argon. It has the atomic number 18. Subtracting 19-18 we get 1 electron. Argon lies in 3rd row. Starting with 4, we get 4s1.
So the short electronic configuration is
[Ar] 4s1.
For long term electronic configuration we must write the electronic configuration of the noble gas as well.
So for Carbon it is 1s2 2s2 2p2.
For potassium it is 1s2 2s2 2p6 3s2 3p6 4s1
