Answer:
because a fruit holds the seeds it needs to reproduce and continue living.
Answer:
The correct answer is - both act only between non-atomic particles.
Explanation:
The decreasing order of their relative strength is - the strong force, electromagnetism, weak force, gravity.
so, A would be here = gravity
B would be = weak force
C would be = strong force
The weak and strong forces both are fundamental forces that act on sub-atomic particles only such as quarks.
The reaction, Fe2O3 + 3CO------> 2Fe + 3CO2 is an oxidation-reduction reaction.
An oxidation-reduction reaction is a reaction in which there is a change in oxidation number from left to right in the reaction. This is because, a specie is oxidized and another specie is reduced.
In the reaction; Fe2O3 + 3CO------> 2Fe + 3CO2, we can see that the oxidation number of iron decreased from +3 on the left hand side to zero on the right hand side. The oxidation number of carbon was increased from + 2 to +4.
Learn more: brainly.com/question/10079361
Electrolysis can be used to separate a substance into its original components/elements and it was through this process that a number of elements have been discovered and are still produced in today's industry.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
