Answer:
it is b
Explanation:
mid ocean ridge diverges meaning it moving in two different direction horizontally - left to right
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
3.10×10¯⁵ ft³.
Explanation:
The following data were obtained from the question:
Density (D) of lead = 11.4 g/cm³
Mass (m) of lead = 10 g
Volume (V) of lead =.?
Density (D) = mass (m) / Volume (V)
D = m/V
11.4 = 10 / V
Cross multiply
11.4 × V = 10
Divide both side by 11.4
V = 10 / 11.4
V = 0.877 cm³
Finally, we shall convert 0.877 cm³ to ft³. This can be obtained as follow:
1 cm³ = 3.531×10¯⁵ ft³
Therefore,
0.877 cm³ = 0.877 cm³ × 3.531×10¯⁵ ft³ /1 cm³
0.877 cm³ = 3.10×10¯⁵ ft³
Thus, 0.877 cm³ is equivalent to 3.10×10¯⁵ ft³.
Therefore, the volume of the lead in ft³ is 3.10×10¯⁵ ft³.
Answer:
The question is not complete, the complete question should be "Lipids vesicles are formed containing pure water. If these vesicles are transferred to a solution that contains a rather high concentration of solutes, the solution outside the vesicle is said to be Hypertonic. True or False"
The answer is True
Explanation:
This is because it contains greater concentration of solutes on the outside of the cell than the increase.
In other words hypertonic solutions have more concentrate of solutions on the outside than the inside.
