Answer:
The correct answer is C. element
Explanation:
The sample cannot be an element because an element - or <em>elemental substance</em> - cannot be decomposed into simpler substances. Thus, it cannot be composed by differents types of atoms. For example, an element is carbon (C).
As the sample contains <u>three types of atoms</u>, it can be a compound, a molecule or a mixture, because they can be composed by different types of atoms - of different chemical elements. For example, the sample could contain the element carbon (C) combined with other elements, for example oxygen (O) or hydrogen (H), amoing others.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
Explanation if an object is in motion and more force is applied to it, the object will begin moving faster. If two objects have the same mass and a greater force is applied to one of the objects, the object which receives the greater force will change speeds more quickly.:
