Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
Answer:
Filtration is the best method or seiving to put the drink in a cup while the seed falls on the seiver
Explanation:
Answer:
The volume of the gas will be 78.31 L at 1.7 °C.
Explanation:
We can find the temperature of the gas by the ideal gas law equation:
Where:
n: is the number of moles
V: is the volume
T: is the temperature
R: is the gas constant = 0.082 L*atm/(K*mol)
From the initial we can find the number of moles:
Now, we can find the temperature with the final conditions:
The temperature in Celsius is:
Therefore, the volume of the gas will be 78.31 L at 1.7 °C.
I hope it helps you!
Answer is B- F has a smaller radius than F− because an additional electron causes greater repulsion in F− is the correct choice and the nuclear charge the radius of the anion increases.
Explanation: I hoped that helped!
Answer:
The difference between the Thompson's plum pudding model and the Rutherford atom model is the location of the electrons (option a).
Explanation:
While Thompson compared his atom to a plum pudding, where the electrons floated freely in the pudding, Rutherford established the arrangement of the electrons in orbitals, which were found around the atomic nucleus like the planets around the sun.
Rutherford's findings also established the existence of a small, positively charged nucleus.
<em>Thompson and Rutherford models did not differentiate between the charges of electrons and protons
, overall charges or overall size of the atom.</em>
