Can anyone please help?

A sample of gaseous methyl ether has a mass of 8.12g and occupies a volume of 3.96L at STP. What is the molecular weight of meth

Naya [18.7K]

Molar volume is when 1 mol of any gas occupies 22.4 L at STP.
Methyl ether has a mass of 8.12 g,
Volume occupied - 3.96 L
If 22.4 L occupied by 1 mol of gas
Then 3.96 L occupied by 1/22.4 x 3.96 = 0.176 mol of gas
The mass of 0.176 mol = 8.12 g
Molar mass is mass of 1 mol
Therefore mass of 1 mol = 8.12/0.176 = 46.1
Molecular weight is 46.1 g/mol

5 0

3 years ago

Which of the following is equal to 3.3mm3? A) 3.3 x 10^-6 m^3 B) 3.3 x 10^-9 m^3 C) 3.3 x 10^-6 cm^3 D) 3.3 x 10^-9 cm^3

vazorg [7]

Step 1 - Since 3.3mm^3 = 0.0033cm^3, convert that to 3.3x10^-3 cm^3.

Step 2 - Since 1cm^3 = 1x10^-6 m^3, times 3.3 by that. (3.3 x 1 x 10^-6) = 0.0000033

Step 3 - 0.0000033 = 3.3 x 10 ^-6 m^3, which is your answer choice A.

*if you do not understand, message me and I will go through it more thoroughly!!*

Have a great day!! :)

3 0

3 years ago

After the hare population increased, what happened to the lynx population? Why?

Westkost [7]

The lynx population increased as well because hare are the prey and the lynx are the predators.

5 0

3 years ago

1. Propane gas (C3H8) burns completely in the presence of oxygen gas (O2) to yield carbon dioxide gas (CO2) and water vapor (H2O

vovikov84 [41]

1) Balanced equation

C3H8 + 5O2 -> 3 CO2 + 4 H2O

2) 0.700 L C3H8

Given the pressure and temperature do not change, the molar ratio is equivalent to volume ratio

1molC3H8 / 5 mol O2 => 1 L C3H8 / 5 L O2

0.700 L C3H8 / x L O2 = 1 L C3H8 / 5 L O2 => x = 0.700 L C3H8 * 5 L O2 / 1 L C3H8

x = 3.500 L O2

3) CO2 produced

1 L C3H8 / 3 L CO2 = 0.700 L C3H8 / x L CO2 =>

x = 0.700 L C3H8 * 3 L CO2 / 1 L C3H8 = 2.100 L CO2

4) Water vapor produced

1) 1 L C3H8 / 4 L H2O = 0.700 LC3H8 / x L H2O =>

x = 0.700 L C3H8 * 4 L H20 / 1 L C3H8 = 2.800 L H2O

3 0

3 years ago

What are the Common compounds of niobium in which it is found

blagie [28]

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

7 0

3 years ago