Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Hi. Increased evaporation would be the greatest difference.
Explanation:
Have you ever had a drink in a mug with a lid? When you would remove the lid, all of the liquid on the lid is the liquid that would evaporate if there was no lid.
Physical reaction is something you can detect using your senses
Answer:
Newton's Third Law
Explanation:
Newton's Third Law stipulates that for every action there is an equal and opposite reaction.
So when the two players are tackling they exert a force on each other.
If player 1 tackles (exerts a force) player 2, player 2 will exert an equal and opposite reaction on player 1 as stated in Newton's Third Law.
Therefore when they tackle each other so hard they both experience reaction forces so powerful that they fly in opposite directions.
Thus this is an example of the Newton's Third Law.
Answer:
Block Y is heavier than Block X.
Explanation:
