answer:
I think nine
explanation:
Nuclear fission : It is defined as the splitting of bigger nuclei into two smaller nuclei. During this process neutrons and some energy also released.
The given equation is:
<span>N2H4(l) + O2(g) → N2(g) + 2H2O(g)
From the periodic table:
mass of nitrogen = 14 grams
mass of hydrogen = 1 gram
mass of oxygen = 16 grams
Therefore:
molar mass of N2H4 = 2(14) + 4(1) = 32 grams
mass of water = 2(1) + 16 = 18 grams
From the balanced equation:
1 moles of N2H4 produces 2 moles of H2O.
32 grams of N2H4 produce 18*2=36 grams of water
To know the mass of N2H4 needed to produce 96 grams of water, all you need to do is cross multiplication as follows:
mass of N2H4 = (96*32) / 36 = 85.3334 grams</span>
Answer:
Water's polarity allows it to dissolve other polar substances very easily. When a polar substance is put in water, the positive ends of its molecules are attracted to the negative ends of the water molecules, and vice versa.
Explanation:
First, we have to get Ka:
when Ka = Kw / Kb and we have Kb = 3.83 x 10^-4 & Kw = 1 x 10^-14
∴Ka = (1 x 10^-14) / (3.83 x 10^-4)
= 2.6 x 10^-11
according to the reaction equation:
by using ICE table:
C6H5NH3+ + H2O ↔ C6H5NH2 + H3O+
initial 0.726 0 0
change -X +X +X
Equ (0.726 -X) X X
when Ka = [C6H5NH2][H3O+]/[C6H5NH3+]
by substitution:
2.6 x 10^-11 = X*X / (0.726 -X) by solving for X
∴X = 4.3 x 10^-6
when [H3O+] = X = 4.3 x 10^-6
∴PH = -㏒[H3O+]
= -㏒(4.3 x 10^-6)
= 5.4
