The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer is: <span>the volume of water after the solid is added</span> is 4.5 ml.
d(gold) = 8.0 g/cm³; density of gold.
m(gold) = 4 g; mass of gold.
V(gold) = m(gold) ÷ d(gold); volume of gold.
V(gold) = 4 g ÷ 8 g/cm³.
V(gold) = 0.5 cm³ = 0.5 ml.
V(water) = 4.00 ml = 4.00 cm³.
V(flask) = V(gold) + V(water).
V(flask) = 0.5 cm³ + 4 cm³.V = 4.5 cm³.
Answer: 0,4278g of F and 0,4191g of Fe
Explanation: it's possible to calculate the mass of each element by multiplying the percentage (decimal) of the element by the mass of the compound.
For Fluorine (F)
0,847g * 0,5051 = 0,4278g of F
For iron (Fe)
0,847 * 0,4949 = 0,4191g of Fe
This is determined because even when the compound is decomposed, due to conservative law of mass, the decomposition process do not affect the amount of matter, so the mass of the elements remain even if they are separated from the original molecule.
At the end, the sum of the elements masses should be the total mass of the compound.
