Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
The property of potential energy that distinguishes it from kinetic energy are Shape and position
Answer:

Explanation:
Hello!
In this case, when solid calcium carbonate, CaCO3 (s), is decomposed by the action of thermal energy (heat), solid calcium oxide, CaO (s) and carbon dioxide gas, CO2 (g) are yielded via the following reaction:

However, since calcium carbonate is solid as well as calcium oxide and carbon dioxide is given off as a gas, we write:

Which also balanced.
Best regards!
Answer:
c. 157 KJ
Explanation:
Q= mC dT dT= 100°C(boiling point) - 25°C=75°C
Q= (500 g * 4.184 J/g °C * 75 °C)
Q= 156900 J= 157 KJ