Answer:
Mass = 182.4 g
Explanation:
Given data:
Number of moles of Al₂O₃ = 3.80 mol
Mass of oxygen required = ?
Solution:
Chemical equation:
4Al + 3O₂ → 2Al₂O₃
Now we will compare the moles of aluminum oxide and oxygen.
Al₂O₃ : O₂
2 : 3
3.80 : 3/2×3.80 = 5.7
Mass of oxygen:
Mass = number of moles × molar mass
Mass = 5.7 mol × 32 g/mol
Mass = 182.4 g
When light strikes a transparent material, most of the light passes through it it doesn't absorb or reflect it
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Complete question is;
A drop of water has a volume of approximately 7 × 10⁻² ml. How many water molecules does it contain? The density of water is 1.0 g/cm³.
This question will require us to first find the number of moles and then use avogadro's number to get the number of water molecules.
<em><u>Number of water molecules = 2.34 × 10²¹ molecules</u></em>
We are given;
Volume of water; V = 7 × 10⁻² ml
Density of water; ρ = 1 g/cm³ = 1 g/ml
Formula for mass is; m = ρV
m = 1 × 7 × 10⁻²
m = 7 × 10⁻² g
from online calculation, molar mass of water = 18.01 g/mol
Number of moles(n) = mass/molar mass
Thus;
n = (7 × 10⁻²)/18.01
n = 3.887 × 10⁻³ mol
from avogadro's number, we know that;
1 mol = 6.022 × 10²³ molecules
Thus,3.887 × 10⁻³ mol will give; 6.022 × 10²³ × 3.887 × 10⁻³ = 2.34 × 10²¹ molecules
Read more at; brainly.in/question/17990661
Answer:
0.188mol
Explanation:
Using the formula;
mole = mass/molar mass
Molar mass of hypomanganous acid. (H3MnO4) = 1(3) + 55 + 16(4)
= 3 + 55 + 64
= 122g/mol
According to this question, there are 22.912g of H3MnO4
mole = 22.912g ÷ 122g/mol
mole = 0.188mol