Answer:
0.4694 moles of CrCl₃
Explanation:
The balanced equation is:
Cr₂O₃(s) + 3CCl₄(l) → 2CrCl₃(s) + 3COCl₂(aq)
The stoichiometry of the equation is how much moles of the substances must react to form the products, and it's represented by the coefficients of the balanced equation. So, 1 mol of Cr₂O₃ must react with 3 moles of CCl₄ to form 2 moles of CrCl₃ and 3 moles of COCl₂.
The stoichiometry calculus must be on a moles basis. The compounds of interest are Cr₂O₃ and CrCl₃. The molar masses of the elements are:
MCr = 52 g/mol
MCl = 35.5 g/mol
MO = 16 g/mol
So, the molar mass of the Cr₂O₃ is = 2x52 + 3x35.5 = 210.5 g/mol.
The number of moles is the mass divided by the molar mass, so:
n = 49.4/210.5 = 0.2347 mol of Cr₂O₃.
For the stoichiometry:
1 mol of Cr₂O₃ ------------------- 2 moles of CrCl₃
0.2347 mol of Cr₂O₃----------- x
By a simple direct three rule:
x = 0.4694 moles of CrCl₃
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
1. 7 , 2. 0 crackers, 6 choc pieces and 1 marshmallow
Explanatio
Nrjrjffjjdrjrjrjejejdjrjrjrjejrrjdjdkdkrjjrjrjrrjrjrjrjrjrjrjrjrkrk
H20. 2 of hydrogen and oxygen
