The correct description for an atom of helium would be option C. An atom of helium has its valence electrons in its first energy level, it wouldn't and can't satisfy the Octet rule as it only has 2 electrons, but with 2, it has a full shell, as the first energy level can hold only 2 electrons.
As long as matter cannot be destroyed or created , nothing can be gained or lost.
there is zero impact and hence one cannot numerate the impact
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
The IUPAC name of the above mentioned compound is "2-Chloro-4,4-dimethylpentane"
<u>Exaplanation:</u>
- Since the above organic compound is an compound with only one saturated bond, It can be considered as a single bond compound, and hence we can conclude that as alkane.
- It also has 5 carbon atoms, so it is termed as pentane.
- From right to left we have to number the atoms, and 2 nd carbon atom contain Cl atom so it is termed as 2-Chloro and in the 4th position carbon atom contains 2 methyl groups, so it is termed as, 2-Chloro-4,4-dimethylpentane.