Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
The particles begin to vibrate faster and more.
Explanation:
Adding heat to matter increases the energy, thus creating more movement. Eventually, the bucket will melt, turning to a liquid. While it is a sold, it still has particle movement, just not enough to break volume or shape.
